C17H24N2 — CID 63160566
3-[(4,4-diethylpiperidin-1-yl)methyl]benzonitrile (PubChem CID 63160566) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-[(4,4-diethylpiperidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 63160566 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-[(4,4-diethylpiperidin-1-yl)methyl]benzonitrile |
| SMILES | CCC1(CC)CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C17H24N2/c1-3-17(4-2)8-10-19(11-9-17)14-16-7-5-6-15(12-16)13-18/h5-7,12H,3-4,8-11,14H2,1-2H3 |
| InChIKey | ANHKIWIHFPVRMN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |