C24H29N3O — CID 97487811
3-[[(3R)-3-[benzyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methyl]benzonitrile (PubChem CID 97487811) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-[[(3R)-3-[benzyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methyl]benzonitrile.
| Compound Name | 3-[[(3R)-3-[benzyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 97487811 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-[[(3R)-3-[benzyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methyl]benzonitrile |
| SMILES | CN(Cc1ccccc1)[C@H]1COC2(CCN(Cc3cccc(C#N)c3)CC2)C1 |
| InChI | InChI=1S/C24H29N3O/c1-26(17-20-6-3-2-4-7-20)23-15-24(28-19-23)10-12-27(13-11-24)18-22-9-5-8-21(14-22)16-25/h2-9,14,23H,10-13,15,17-19H2,1H3/t23-/m1/s1 |
| InChIKey | IRUQVQMZOFHXQJ-HSZRJFAPSA-N |
| XLogP | 3.81 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |