C19H29FN2O — CID 155878318
N-(2-fluoroethyl)-N-methyl-8-(2-phenylethyl)-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 155878318) has the molecular formula C19H29FN2O and a molecular weight of 320.45 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N-methyl-8-(2-phenylethyl)-1-oxa-8-azaspiro[4.5]decan-3-amine.
| Compound Name | N-(2-fluoroethyl)-N-methyl-8-(2-phenylethyl)-1-oxa-8-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 155878318 |
| Molecular Formula | C19H29FN2O |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-(2-fluoroethyl)-N-methyl-8-(2-phenylethyl)-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | CN(CCF)C1COC2(CCN(CCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C19H29FN2O/c1-21(14-10-20)18-15-19(23-16-18)8-12-22(13-9-19)11-7-17-5-3-2-4-6-17/h2-6,18H,7-16H2,1H3 |
| InChIKey | JUICWWHZTSXGRV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |