C17H25NO — CID 97395102
(3S,5R)-3-methyl-9-(2-phenylethyl)-1-oxa-9-azaspiro[4.5]decane (PubChem CID 97395102) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (3S,5R)-3-methyl-9-(2-phenylethyl)-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3S,5R)-3-methyl-9-(2-phenylethyl)-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97395102 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (3S,5R)-3-methyl-9-(2-phenylethyl)-1-oxa-9-azaspiro[4.5]decane |
| SMILES | C[C@@H]1CO[C@]2(CCCN(CCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C17H25NO/c1-15-12-17(19-13-15)9-5-10-18(14-17)11-8-16-6-3-2-4-7-16/h2-4,6-7,15H,5,8-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | KTYKHZUYFLNWKG-DOTOQJQBSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |