About 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one
6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 67576238) has the molecular formula C20H20N4O2S
and a molecular weight of 380.47 g/mol. Its IUPAC name is 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 67576238 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(CN3CCN(c4nsc5ccccc45)CC3)ccc21 |
| InChI | InChI=1S/C20H20N4O2S/c1-22-16-7-6-14(12-17(16)26-20(22)25)13-23-8-10-24(11-9-23)19-15-4-2-3-5-18(15)27-21-19/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | FKFUQQGHMQLCMO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one (CID 67576238) is 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one is Cn1c(=O)oc2cc(CN3CCN(c4nsc5ccccc45)CC3)ccc21.
What is the InChIKey of 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one?
The InChIKey is FKFUQQGHMQLCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O2S/c1-22-16-7-6-14(12-17(16)26-20(22)25)13-23-8-10-24(11-9-23)19-15-4-2-3-5-18(15)27-21-19/h2-7,12H,8-11,13H2,1H3.
What are the key properties of 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one?
6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one has a molecular weight of 380.47 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-3-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 67576238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).