C26H29N3O5S — CID 145112941
2-methoxy-5-[[4-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperazin-1-yl]methyl]benzoic acid (PubChem CID 145112941) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-methoxy-5-[[4-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 2-methoxy-5-[[4-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 145112941 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-methoxy-5-[[4-[4-[(4-methylphenyl)sulfonylamino]phenyl]piperazin-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(CN2CCN(c3ccc(NS(=O)(=O)c4ccc(C)cc4)cc3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C26H29N3O5S/c1-19-3-10-23(11-4-19)35(32,33)27-21-6-8-22(9-7-21)29-15-13-28(14-16-29)18-20-5-12-25(34-2)24(17-20)26(30)31/h3-12,17,27H,13-16,18H2,1-2H3,(H,30,31) |
| InChIKey | GYZNGSFTWSZJHD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|