C29H35F3N2O4S — CID 145113172
1-[(3,4-dimethoxyphenyl)methyl]-4-[4-[4-(trifluoromethoxy)phenyl]sulfanyloxyphenyl]piperazine;propane (PubChem CID 145113172) has the molecular formula C29H35F3N2O4S and a molecular weight of 564.67 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-[4-[4-(trifluoromethoxy)phenyl]sulfanyloxyphenyl]piperazine;propane.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-[4-[4-(trifluoromethoxy)phenyl]sulfanyloxyphenyl]piperazine;propane |
|---|---|
| PubChem CID | 145113172 |
| Molecular Formula | C29H35F3N2O4S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-[4-[4-(trifluoromethoxy)phenyl]sulfanyloxyphenyl]piperazine;propane |
| SMILES | CCC.COc1ccc(CN2CCN(c3ccc(OSc4ccc(OC(F)(F)F)cc4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C26H27F3N2O4S.C3H8/c1-32-24-12-3-19(17-25(24)33-2)18-30-13-15-31(16-14-30)20-4-6-22(7-5-20)35-36-23-10-8-21(9-11-23)34-26(27,28)29;1-3-2/h3-12,17H,13-16,18H2,1-2H3;3H2,1-2H3 |
| InChIKey | XWTDPJPTDBEKHD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|