C33H37N3O4S — CID 145112937
2-(3,4-dimethoxyphenyl)-1-[4-[4-(4-pyridin-3-ylphenyl)sulfanyloxyphenyl]piperazin-1-yl]ethanone;ethane (PubChem CID 145112937) has the molecular formula C33H37N3O4S and a molecular weight of 571.74 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[4-[4-(4-pyridin-3-ylphenyl)sulfanyloxyphenyl]piperazin-1-yl]ethanone;ethane.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[4-[4-(4-pyridin-3-ylphenyl)sulfanyloxyphenyl]piperazin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 145112937 |
| Molecular Formula | C33H37N3O4S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[4-[4-(4-pyridin-3-ylphenyl)sulfanyloxyphenyl]piperazin-1-yl]ethanone;ethane |
| SMILES | CC.COc1ccc(CC(=O)N2CCN(c3ccc(OSc4ccc(-c5cccnc5)cc4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C31H31N3O4S.C2H6/c1-36-29-14-5-23(20-30(29)37-2)21-31(35)34-18-16-33(17-19-34)26-8-10-27(11-9-26)38-39-28-12-6-24(7-13-28)25-4-3-15-32-22-25;1-2/h3-15,20,22H,16-19,21H2,1-2H3;1-2H3 |
| InChIKey | YNFYYZSTTUCTON-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|