C27H27N3O4S — CID 145112927
4-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]phenoxy]sulfanylbenzonitrile (PubChem CID 145112927) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 4-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]phenoxy]sulfanylbenzonitrile.
| Compound Name | 4-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]phenoxy]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 145112927 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 4-[4-[4-[2-(3,4-dimethoxyphenyl)acetyl]piperazin-1-yl]phenoxy]sulfanylbenzonitrile |
| SMILES | COc1ccc(CC(=O)N2CCN(c3ccc(OSc4ccc(C#N)cc4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C27H27N3O4S/c1-32-25-12-5-21(17-26(25)33-2)18-27(31)30-15-13-29(14-16-30)22-6-8-23(9-7-22)34-35-24-10-3-20(19-28)4-11-24/h3-12,17H,13-16,18H2,1-2H3 |
| InChIKey | IEFYQVKWBOWALC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|