C27H28BrCl3N2O2 — CID 66541050
N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline (PubChem CID 66541050) has the molecular formula C27H28BrCl3N2O2 and a molecular weight of 598.80 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline.
| Compound Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 66541050 |
| Molecular Formula | C27H28BrCl3N2O2 |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-chloro-4-piperidin-1-ylaniline |
| SMILES | CCOc1cc(CNc2ccc(N3CCCCC3)c(Cl)c2)c(Br)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H28BrCl3N2O2/c1-2-34-26-13-18(21(28)15-27(26)35-17-20-22(29)7-6-8-23(20)30)16-32-19-9-10-25(24(31)14-19)33-11-4-3-5-12-33/h6-10,13-15,32H,2-5,11-12,16-17H2,1H3 |
| InChIKey | DGMUDXZZAJXEFG-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|