C22H27BrCl2N2O3 — CID 66538131
N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 66538131) has the molecular formula C22H27BrCl2N2O3 and a molecular weight of 518.28 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 66538131 |
| Molecular Formula | C22H27BrCl2N2O3 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | COc1cc(CNCCCN2CCOCC2)c(Br)cc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H27BrCl2N2O3/c1-28-21-12-16(14-26-6-3-7-27-8-10-29-11-9-27)18(23)13-22(21)30-15-17-19(24)4-2-5-20(17)25/h2,4-5,12-13,26H,3,6-11,14-15H2,1H3 |
| InChIKey | JUBASBNQXNVSCI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|