C24H33N3O5 — CID 2981319
2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 2981319) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2981319 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(CNCCCN3CCOCC3)cc2OC)cc1 |
| InChI | InChI=1S/C24H33N3O5/c1-29-21-7-5-20(6-8-21)26-24(28)18-32-22-9-4-19(16-23(22)30-2)17-25-10-3-11-27-12-14-31-15-13-27/h4-9,16,25H,3,10-15,17-18H2,1-2H3,(H,26,28) |
| InChIKey | KPULOOJNQVPQCZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|