C24H32Cl2F3N3O4 — CID 90481302
2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide;dihydrochloride (PubChem CID 90481302) has the molecular formula C24H32Cl2F3N3O4 and a molecular weight of 554.44 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 90481302 |
| Molecular Formula | C24H32Cl2F3N3O4 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 2-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
| SMILES | COc1cc(CNCCCN2CCOCC2)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C24H30F3N3O4.2ClH/c1-32-22-14-18(16-28-8-3-9-30-10-12-33-13-11-30)6-7-21(22)34-17-23(31)29-20-5-2-4-19(15-20)24(25,26)27;;/h2,4-7,14-15,28H,3,8-13,16-17H2,1H3,(H,29,31);2*1H |
| InChIKey | BLVLAEQCCGCFTK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|