C21H20BrF3N2O4S — CID 126268540
2-[2-bromo-6-methoxy-4-(morpholine-4-carbothioyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126268540) has the molecular formula C21H20BrF3N2O4S and a molecular weight of 533.37 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-(morpholine-4-carbothioyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-(morpholine-4-carbothioyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126268540 |
| Molecular Formula | C21H20BrF3N2O4S |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-(morpholine-4-carbothioyl)phenoxy]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(C(=S)N2CCOCC2)cc(Br)c1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20BrF3N2O4S/c1-29-17-10-13(20(32)27-5-7-30-8-6-27)9-16(22)19(17)31-12-18(28)26-15-4-2-3-14(11-15)21(23,24)25/h2-4,9-11H,5-8,12H2,1H3,(H,26,28) |
| InChIKey | HDFFKPJIJHHIIS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|