C22H30N4O7S — CID 90748819
[[6-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid (PubChem CID 90748819) has the molecular formula C22H30N4O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is [[6-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[6-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90748819 |
| Molecular Formula | C22H30N4O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [[6-[2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
| SMILES | COc1cc(CNCCCN2CCOCC2)ccc1Oc1ccc(C(=O)NCS(=O)(=O)O)cn1 |
| InChI | InChI=1S/C22H30N4O7S/c1-31-20-13-17(14-23-7-2-8-26-9-11-32-12-10-26)3-5-19(20)33-21-6-4-18(15-24-21)22(27)25-16-34(28,29)30/h3-6,13,15,23H,2,7-12,14,16H2,1H3,(H,25,27)(H,28,29,30) |
| InChIKey | NEPZWSFAJUSYHZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|