C18H25N3O6S — CID 87561327
methanesulfonic acid;6-[2-methoxy-4-(propylaminomethyl)phenoxy]pyridine-3-carboxamide (PubChem CID 87561327) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is methanesulfonic acid;6-[2-methoxy-4-(propylaminomethyl)phenoxy]pyridine-3-carboxamide.
| Compound Name | methanesulfonic acid;6-[2-methoxy-4-(propylaminomethyl)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87561327 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methanesulfonic acid;6-[2-methoxy-4-(propylaminomethyl)phenoxy]pyridine-3-carboxamide |
| SMILES | CCCNCc1ccc(Oc2ccc(C(N)=O)cn2)c(OC)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H21N3O3.CH4O3S/c1-3-8-19-10-12-4-6-14(15(9-12)22-2)23-16-7-5-13(11-20-16)17(18)21;1-5(2,3)4/h4-7,9,11,19H,3,8,10H2,1-2H3,(H2,18,21);1H3,(H,2,3,4) |
| InChIKey | JFILNKMXKVQMEZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|