C20H30N4O6S — CID 87560923
6-[4-[(3,3-dimethylbutylamino)methyl]-2-methoxyphenoxy]pyridazine-3-carboxamide;methanesulfonic acid (PubChem CID 87560923) has the molecular formula C20H30N4O6S and a molecular weight of 454.55 g/mol. Its IUPAC name is 6-[4-[(3,3-dimethylbutylamino)methyl]-2-methoxyphenoxy]pyridazine-3-carboxamide;methanesulfonic acid.
| Compound Name | 6-[4-[(3,3-dimethylbutylamino)methyl]-2-methoxyphenoxy]pyridazine-3-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87560923 |
| Molecular Formula | C20H30N4O6S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-[4-[(3,3-dimethylbutylamino)methyl]-2-methoxyphenoxy]pyridazine-3-carboxamide;methanesulfonic acid |
| SMILES | COc1cc(CNCCC(C)(C)C)ccc1Oc1ccc(C(N)=O)nn1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H26N4O3.CH4O3S/c1-19(2,3)9-10-21-12-13-5-7-15(16(11-13)25-4)26-17-8-6-14(18(20)24)22-23-17;1-5(2,3)4/h5-8,11,21H,9-10,12H2,1-4H3,(H2,20,24);1H3,(H,2,3,4) |
| InChIKey | NBJZWGFSIWZZAO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|