C20H27FN3O3+ — CID 153180788
6-[4-[(3,3-dimethylbutylamino)methyl]-2-fluoro-6-methoxyphenoxy]pyridin-1-ium-3-carboxamide (PubChem CID 153180788) has the molecular formula C20H27FN3O3+ and a molecular weight of 376.45 g/mol. Its IUPAC name is 6-[4-[(3,3-dimethylbutylamino)methyl]-2-fluoro-6-methoxyphenoxy]pyridin-1-ium-3-carboxamide.
| Compound Name | 6-[4-[(3,3-dimethylbutylamino)methyl]-2-fluoro-6-methoxyphenoxy]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 153180788 |
| Molecular Formula | C20H27FN3O3+ |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-[4-[(3,3-dimethylbutylamino)methyl]-2-fluoro-6-methoxyphenoxy]pyridin-1-ium-3-carboxamide |
| SMILES | COc1cc(CNCCC(C)(C)C)cc(F)c1Oc1ccc(C(N)=O)c[nH+]1 |
| InChI | InChI=1S/C20H26FN3O3/c1-20(2,3)7-8-23-11-13-9-15(21)18(16(10-13)26-4)27-17-6-5-14(12-24-17)19(22)25/h5-6,9-10,12,23H,7-8,11H2,1-4H3,(H2,22,25)/p+1 |
| InChIKey | WGCYEUMXKPHFPH-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|