C17H27NO5 — CID 122126903
4-[(4-ethoxy-3,5-dimethoxyphenyl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122126903) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126903 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 4-[(4-ethoxy-3,5-dimethoxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CCOc1c(OC)cc(CNCCC(C)(C)C(=O)O)cc1OC |
| InChI | InChI=1S/C17H27NO5/c1-6-23-15-13(21-4)9-12(10-14(15)22-5)11-18-8-7-17(2,3)16(19)20/h9-10,18H,6-8,11H2,1-5H3,(H,19,20) |
| InChIKey | WLGWPADSVOKVNV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|