C18H29NO4 — CID 122126744
4-[(3-ethoxy-4-propoxyphenyl)methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122126744) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 4-[(3-ethoxy-4-propoxyphenyl)methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(3-ethoxy-4-propoxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122126744 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 4-[(3-ethoxy-4-propoxyphenyl)methylamino]-2,2-dimethylbutanoic acid |
| SMILES | CCCOc1ccc(CNCCC(C)(C)C(=O)O)cc1OCC |
| InChI | InChI=1S/C18H29NO4/c1-5-11-23-15-8-7-14(12-16(15)22-6-2)13-19-10-9-18(3,4)17(20)21/h7-8,12,19H,5-6,9-11,13H2,1-4H3,(H,20,21) |
| InChIKey | FSIUWNUTXPZLID-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|