C20H25NO4 — CID 29227556
4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]benzoic acid (PubChem CID 29227556) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 29227556 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]benzoic acid |
| SMILES | CCCOc1ccc(CNCc2ccc(C(=O)O)cc2)cc1OCC |
| InChI | InChI=1S/C20H25NO4/c1-3-11-25-18-10-7-16(12-19(18)24-4-2)14-21-13-15-5-8-17(9-6-15)20(22)23/h5-10,12,21H,3-4,11,13-14H2,1-2H3,(H,22,23) |
| InChIKey | BEYZGQLGEOQVKH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |