C18H23N3O3 — CID 122127500
4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methylamino]-2,2-dimethylbutanoic acid (PubChem CID 122127500) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methylamino]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methylamino]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 122127500 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[[2-(2-methoxyphenyl)pyrimidin-5-yl]methylamino]-2,2-dimethylbutanoic acid |
| SMILES | COc1ccccc1-c1ncc(CNCCC(C)(C)C(=O)O)cn1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,17(22)23)8-9-19-10-13-11-20-16(21-12-13)14-6-4-5-7-15(14)24-3/h4-7,11-12,19H,8-10H2,1-3H3,(H,22,23) |
| InChIKey | NRQYQXBZZHSATM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|