C14H18F3NO2S — CID 122126838
2,2-dimethyl-4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]butanoic acid (PubChem CID 122126838) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2,2-dimethyl-4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]butanoic acid.
| Compound Name | 2,2-dimethyl-4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 122126838 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2,2-dimethyl-4-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]butanoic acid |
| SMILES | CC(C)(CCNCc1ccc(SC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H18F3NO2S/c1-13(2,12(19)20)7-8-18-9-10-3-5-11(6-4-10)21-14(15,16)17/h3-6,18H,7-9H2,1-2H3,(H,19,20) |
| InChIKey | RWIWAPWYYLHVTN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|