C11H14F3NS2 — CID 60699399
2-methylsulfanyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine (PubChem CID 60699399) has the molecular formula C11H14F3NS2 and a molecular weight of 281.37 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine.
| Compound Name | 2-methylsulfanyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 60699399 |
| Molecular Formula | C11H14F3NS2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-methylsulfanyl-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
| SMILES | CSCCNCc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NS2/c1-16-7-6-15-8-9-2-4-10(5-3-9)17-11(12,13)14/h2-5,15H,6-8H2,1H3 |
| InChIKey | WREHRBSYNHGQEC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|