C11H13F4NS — CID 113263640
3-fluoro-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 113263640) has the molecular formula C11H13F4NS and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-fluoro-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 113263640 |
| Molecular Formula | C11H13F4NS |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-fluoro-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | FCCCNCc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F4NS/c12-6-1-7-16-8-9-2-4-10(5-3-9)17-11(13,14)15/h2-5,16H,1,6-8H2 |
| InChIKey | HPVCTTQYUTZDFO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|