C15H13ClF3NS — CID 29053761
N-[(2-chlorophenyl)methyl]-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine (PubChem CID 29053761) has the molecular formula C15H13ClF3NS and a molecular weight of 331.79 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 29053761 |
| Molecular Formula | C15H13ClF3NS |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
| SMILES | FC(F)(F)Sc1ccc(CNCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H13ClF3NS/c16-14-4-2-1-3-12(14)10-20-9-11-5-7-13(8-6-11)21-15(17,18)19/h1-8,20H,9-10H2 |
| InChIKey | QJBHQXMKTBZZMK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |