C13H12F3NOS — CID 16775123
N-(furan-2-ylmethyl)-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine (PubChem CID 16775123) has the molecular formula C13H12F3NOS and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine.
| Compound Name | N-(furan-2-ylmethyl)-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 16775123 |
| Molecular Formula | C13H12F3NOS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[4-(trifluoromethylsulfanyl)phenyl]methanamine |
| SMILES | FC(F)(F)Sc1ccc(CNCc2ccco2)cc1 |
| InChI | InChI=1S/C13H12F3NOS/c14-13(15,16)19-12-5-3-10(4-6-12)8-17-9-11-2-1-7-18-11/h1-7,17H,8-9H2 |
| InChIKey | JYTSWPAHDUDXOD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |