C18H23NO5 — CID 17382599
1-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid (PubChem CID 17382599) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid.
| Compound Name | 1-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 17382599 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid |
| SMILES | CC(C)(C)c1ccc(CNCc2ccco2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H21NO.C2H2O4/c1-16(2,3)14-8-6-13(7-9-14)11-17-12-15-5-4-10-18-15;3-1(4)2(5)6/h4-10,17H,11-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | DWVXLSKEKWAMIN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|