C13H17F3N2O2S — CID 115575340
N-(2-methoxyethyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]acetamide (PubChem CID 115575340) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]acetamide |
|---|---|
| PubChem CID | 115575340 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]acetamide |
| SMILES | COCCNC(=O)CNCc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-20-7-6-18-12(19)9-17-8-10-2-4-11(5-3-10)21-13(14,15)16/h2-5,17H,6-9H2,1H3,(H,18,19) |
| InChIKey | ZHWQOQHVPXBXKZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|