C23H29N3O — CID 11772899
4-[[5-[(3,3-dimethylbutylamino)methyl]indol-1-yl]methyl]benzamide (PubChem CID 11772899) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 4-[[5-[(3,3-dimethylbutylamino)methyl]indol-1-yl]methyl]benzamide.
| Compound Name | 4-[[5-[(3,3-dimethylbutylamino)methyl]indol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11772899 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 4-[[5-[(3,3-dimethylbutylamino)methyl]indol-1-yl]methyl]benzamide |
| SMILES | CC(C)(C)CCNCc1ccc2c(ccn2Cc2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C23H29N3O/c1-23(2,3)11-12-25-15-18-6-9-21-20(14-18)10-13-26(21)16-17-4-7-19(8-5-17)22(24)27/h4-10,13-14,25H,11-12,15-16H2,1-3H3,(H2,24,27) |
| InChIKey | NALWJKMHKJWEOH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|