C16H23N3O — CID 102915996
N-ethyl-2-[5-(propylaminomethyl)indol-1-yl]acetamide (PubChem CID 102915996) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-ethyl-2-[5-(propylaminomethyl)indol-1-yl]acetamide.
| Compound Name | N-ethyl-2-[5-(propylaminomethyl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 102915996 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-ethyl-2-[5-(propylaminomethyl)indol-1-yl]acetamide |
| SMILES | CCCNCc1ccc2c(ccn2CC(=O)NCC)c1 |
| InChI | InChI=1S/C16H23N3O/c1-3-8-17-11-13-5-6-15-14(10-13)7-9-19(15)12-16(20)18-4-2/h5-7,9-10,17H,3-4,8,11-12H2,1-2H3,(H,18,20) |
| InChIKey | UVJGXCIRLLKETL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|