C17H25N3O — CID 102915998
N,N-dimethyl-3-[5-(propylaminomethyl)indol-1-yl]propanamide (PubChem CID 102915998) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N,N-dimethyl-3-[5-(propylaminomethyl)indol-1-yl]propanamide.
| Compound Name | N,N-dimethyl-3-[5-(propylaminomethyl)indol-1-yl]propanamide |
|---|---|
| PubChem CID | 102915998 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N,N-dimethyl-3-[5-(propylaminomethyl)indol-1-yl]propanamide |
| SMILES | CCCNCc1ccc2c(ccn2CCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H25N3O/c1-4-9-18-13-14-5-6-16-15(12-14)7-10-20(16)11-8-17(21)19(2)3/h5-7,10,12,18H,4,8-9,11,13H2,1-3H3 |
| InChIKey | NYRDWYXCKREHNF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|