C14H20N2O — CID 102915831
3-[5-(ethylaminomethyl)indol-1-yl]propan-1-ol (PubChem CID 102915831) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-[5-(ethylaminomethyl)indol-1-yl]propan-1-ol.
| Compound Name | 3-[5-(ethylaminomethyl)indol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 102915831 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[5-(ethylaminomethyl)indol-1-yl]propan-1-ol |
| SMILES | CCNCc1ccc2c(ccn2CCCO)c1 |
| InChI | InChI=1S/C14H20N2O/c1-2-15-11-12-4-5-14-13(10-12)6-8-16(14)7-3-9-17/h4-6,8,10,15,17H,2-3,7,9,11H2,1H3 |
| InChIKey | NJPGZGPOVSRBIC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |