C13H15N3 — CID 102915930
2-[5-(ethylaminomethyl)indol-1-yl]acetonitrile (PubChem CID 102915930) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[5-(ethylaminomethyl)indol-1-yl]acetonitrile.
| Compound Name | 2-[5-(ethylaminomethyl)indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 102915930 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[5-(ethylaminomethyl)indol-1-yl]acetonitrile |
| SMILES | CCNCc1ccc2c(ccn2CC#N)c1 |
| InChI | InChI=1S/C13H15N3/c1-2-15-10-11-3-4-13-12(9-11)5-7-16(13)8-6-14/h3-5,7,9,15H,2,8,10H2,1H3 |
| InChIKey | UFXSZDXCHPOKNC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |