C19H25N3O3 — CID 142891069
3-methoxy-4-[[5-[(3-methylbutylamino)methyl]-2-pyridinyl]oxy]benzamide (PubChem CID 142891069) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-methoxy-4-[[5-[(3-methylbutylamino)methyl]-2-pyridinyl]oxy]benzamide.
| Compound Name | 3-methoxy-4-[[5-[(3-methylbutylamino)methyl]-2-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 142891069 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-methoxy-4-[[5-[(3-methylbutylamino)methyl]-2-pyridinyl]oxy]benzamide |
| SMILES | COc1cc(C(N)=O)ccc1Oc1ccc(CNCCC(C)C)cn1 |
| InChI | InChI=1S/C19H25N3O3/c1-13(2)8-9-21-11-14-4-7-18(22-12-14)25-16-6-5-15(19(20)23)10-17(16)24-3/h4-7,10,12-13,21H,8-9,11H2,1-3H3,(H2,20,23) |
| InChIKey | GJTSUJNFLZZJQL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|