C20H27N3O6S — CID 87559416
[[6-[2-methoxy-4-[(3-methylbutylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid (PubChem CID 87559416) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is [[6-[2-methoxy-4-[(3-methylbutylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[6-[2-methoxy-4-[(3-methylbutylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 87559416 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [[6-[2-methoxy-4-[(3-methylbutylamino)methyl]phenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
| SMILES | COc1cc(CNCCC(C)C)ccc1Oc1ccc(C(=O)NCS(=O)(=O)O)cn1 |
| InChI | InChI=1S/C20H27N3O6S/c1-14(2)8-9-21-11-15-4-6-17(18(10-15)28-3)29-19-7-5-16(12-22-19)20(24)23-13-30(25,26)27/h4-7,10,12,14,21H,8-9,11,13H2,1-3H3,(H,23,24)(H,25,26,27) |
| InChIKey | JNEUJMQCZGEENR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|