C21H23N3O6S2 — CID 90867510
[[5-[2-methoxy-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid (PubChem CID 90867510) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is [[5-[2-methoxy-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[5-[2-methoxy-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90867510 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [[5-[2-methoxy-4-[(2-thiophen-2-ylethylamino)methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
| SMILES | COc1cc(CNCCc2cccs2)ccc1Oc1ccc(C(=O)NCS(=O)(=O)O)nc1 |
| InChI | InChI=1S/C21H23N3O6S2/c1-29-20-11-15(12-22-9-8-17-3-2-10-31-17)4-7-19(20)30-16-5-6-18(23-13-16)21(25)24-14-32(26,27)28/h2-7,10-11,13,22H,8-9,12,14H2,1H3,(H,24,25)(H,26,27,28) |
| InChIKey | JWSGJPYYDONLKX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|