C23H25N3O6S — CID 91022651
[[5-[4-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid (PubChem CID 91022651) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is [[5-[4-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[5-[4-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 91022651 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [[5-[4-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
| SMILES | COc1ccc(CCNCc2ccc(Oc3ccc(C(=O)NCS(=O)(=O)O)nc3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O6S/c1-31-19-6-2-17(3-7-19)12-13-24-14-18-4-8-20(9-5-18)32-21-10-11-22(25-15-21)23(27)26-16-33(28,29)30/h2-11,15,24H,12-14,16H2,1H3,(H,26,27)(H,28,29,30) |
| InChIKey | IEQVCEVLFSGYSB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|