C22H29N3O5S — CID 90982273
[[5-[4-[(2-cyclopentylethylamino)methyl]-2-methylphenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid (PubChem CID 90982273) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is [[5-[4-[(2-cyclopentylethylamino)methyl]-2-methylphenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[5-[4-[(2-cyclopentylethylamino)methyl]-2-methylphenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90982273 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [[5-[4-[(2-cyclopentylethylamino)methyl]-2-methylphenoxy]pyridine-2-carbonyl]amino]methanesulfonic acid |
| SMILES | Cc1cc(CNCCC2CCCC2)ccc1Oc1ccc(C(=O)NCS(=O)(=O)O)nc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-16-12-18(13-23-11-10-17-4-2-3-5-17)6-9-21(16)30-19-7-8-20(24-14-19)22(26)25-15-31(27,28)29/h6-9,12,14,17,23H,2-5,10-11,13,15H2,1H3,(H,25,26)(H,27,28,29) |
| InChIKey | LMDXBVDZQWSKTD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|