C21H29N3O5S — CID 87560491
5-[4-[(2-cyclopentylethylamino)methyl]phenoxy]pyridine-2-carboxamide;methanesulfonic acid (PubChem CID 87560491) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is 5-[4-[(2-cyclopentylethylamino)methyl]phenoxy]pyridine-2-carboxamide;methanesulfonic acid.
| Compound Name | 5-[4-[(2-cyclopentylethylamino)methyl]phenoxy]pyridine-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87560491 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 5-[4-[(2-cyclopentylethylamino)methyl]phenoxy]pyridine-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)c1ccc(Oc2ccc(CNCCC3CCCC3)cc2)cn1 |
| InChI | InChI=1S/C20H25N3O2.CH4O3S/c21-20(24)19-10-9-18(14-23-19)25-17-7-5-16(6-8-17)13-22-12-11-15-3-1-2-4-15;1-5(2,3)4/h5-10,14-15,22H,1-4,11-13H2,(H2,21,24);1H3,(H,2,3,4) |
| InChIKey | DKAWYEWIYUYMSM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|