C19H24FN3O2 — CID 59730177
5-[2-fluoro-4-[(4-methylpentylamino)methyl]phenoxy]pyridine-2-carboxamide (PubChem CID 59730177) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 5-[2-fluoro-4-[(4-methylpentylamino)methyl]phenoxy]pyridine-2-carboxamide.
| Compound Name | 5-[2-fluoro-4-[(4-methylpentylamino)methyl]phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59730177 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 5-[2-fluoro-4-[(4-methylpentylamino)methyl]phenoxy]pyridine-2-carboxamide |
| SMILES | CC(C)CCCNCc1ccc(Oc2ccc(C(N)=O)nc2)c(F)c1 |
| InChI | InChI=1S/C19H24FN3O2/c1-13(2)4-3-9-22-11-14-5-8-18(16(20)10-14)25-15-6-7-17(19(21)24)23-12-15/h5-8,10,12-13,22H,3-4,9,11H2,1-2H3,(H2,21,24) |
| InChIKey | LNJLBVFNRJLICL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|