C18H23FN4O2 — CID 59730293
5-[2-fluoro-4-[(hexylamino)methyl]phenoxy]pyrazine-2-carboxamide (PubChem CID 59730293) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-[2-fluoro-4-[(hexylamino)methyl]phenoxy]pyrazine-2-carboxamide.
| Compound Name | 5-[2-fluoro-4-[(hexylamino)methyl]phenoxy]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59730293 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-[2-fluoro-4-[(hexylamino)methyl]phenoxy]pyrazine-2-carboxamide |
| SMILES | CCCCCCNCc1ccc(Oc2cnc(C(N)=O)cn2)c(F)c1 |
| InChI | InChI=1S/C18H23FN4O2/c1-2-3-4-5-8-21-10-13-6-7-16(14(19)9-13)25-17-12-22-15(11-23-17)18(20)24/h6-7,9,11-12,21H,2-5,8,10H2,1H3,(H2,20,24) |
| InChIKey | PNKBCQUMYPFWHE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|