C25H26Cl3N3O3S — CID 59849845
3,4-dichloro-N-[5-chloro-2-[4-[(2-cyclopentylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 59849845) has the molecular formula C25H26Cl3N3O3S and a molecular weight of 554.93 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-[4-[(2-cyclopentylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-[4-[(2-cyclopentylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59849845 |
| Molecular Formula | C25H26Cl3N3O3S |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-[4-[(2-cyclopentylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cnc1Oc1ccc(CNCCC2CCCC2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H26Cl3N3O3S/c26-19-13-24(31-35(32,33)21-9-10-22(27)23(28)14-21)25(30-16-19)34-20-7-5-18(6-8-20)15-29-12-11-17-3-1-2-4-17/h5-10,13-14,16-17,29,31H,1-4,11-12,15H2 |
| InChIKey | RNSNZQUUSDUNCC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|