C21H18Cl3N3O5S — CID 59850007
2-[[5-chloro-3-[(3,4-dichlorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide (PubChem CID 59850007) has the molecular formula C21H18Cl3N3O5S and a molecular weight of 530.82 g/mol. Its IUPAC name is 2-[[5-chloro-3-[(3,4-dichlorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-[[5-chloro-3-[(3,4-dichlorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 59850007 |
| Molecular Formula | C21H18Cl3N3O5S |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 2-[[5-chloro-3-[(3,4-dichlorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccccc1Oc1ncc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl3N3O5S/c1-31-9-8-25-20(28)15-4-2-3-5-19(15)32-21-18(10-13(22)12-26-21)27-33(29,30)14-6-7-16(23)17(24)11-14/h2-7,10-12,27H,8-9H2,1H3,(H,25,28) |
| InChIKey | HAOFCYWFFXYRML-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|