C24H25ClN2O5S — CID 43009499
2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]benzamide (PubChem CID 43009499) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]benzamide.
| Compound Name | 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 43009499 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-chloro-5-[(3,4-dimethylphenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1cc(S(=O)(=O)Nc2ccc(C)c(C)c2)ccc1Cl |
| InChI | InChI=1S/C24H25ClN2O5S/c1-16-8-9-18(14-17(16)2)27-33(29,30)19-10-11-21(25)20(15-19)24(28)26-12-13-32-23-7-5-4-6-22(23)31-3/h4-11,14-15,27H,12-13H2,1-3H3,(H,26,28) |
| InChIKey | ZUNBLJYXMCLPEJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|