C23H22ClFN2O5S — CID 55947799
2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylbenzamide (PubChem CID 55947799) has the molecular formula C23H22ClFN2O5S and a molecular weight of 492.96 g/mol. Its IUPAC name is 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylbenzamide.
| Compound Name | 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55947799 |
| Molecular Formula | C23H22ClFN2O5S |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 2-chloro-5-[(4-fluorophenyl)sulfamoyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylbenzamide |
| SMILES | COc1ccccc1OCCN(C)C(=O)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C23H22ClFN2O5S/c1-27(13-14-32-22-6-4-3-5-21(22)31-2)23(28)19-15-18(11-12-20(19)24)33(29,30)26-17-9-7-16(25)8-10-17/h3-12,15,26H,13-14H2,1-2H3 |
| InChIKey | ICDGBGSBLDHOTN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |