C20H25ClN2O5S — CID 46558858
2-chloro-N-[2-(2-methoxyphenoxy)ethyl]-5-[methyl(propan-2-yl)sulfamoyl]benzamide (PubChem CID 46558858) has the molecular formula C20H25ClN2O5S and a molecular weight of 440.95 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methoxyphenoxy)ethyl]-5-[methyl(propan-2-yl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-[2-(2-methoxyphenoxy)ethyl]-5-[methyl(propan-2-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 46558858 |
| Molecular Formula | C20H25ClN2O5S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-chloro-N-[2-(2-methoxyphenoxy)ethyl]-5-[methyl(propan-2-yl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1cc(S(=O)(=O)N(C)C(C)C)ccc1Cl |
| InChI | InChI=1S/C20H25ClN2O5S/c1-14(2)23(3)29(25,26)15-9-10-17(21)16(13-15)20(24)22-11-12-28-19-8-6-5-7-18(19)27-4/h5-10,13-14H,11-12H2,1-4H3,(H,22,24) |
| InChIKey | PUWIRUXMOGRJRM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|