C18H23N3O4S — CID 119502214
5-[(2-methoxyphenyl)sulfamoyl]-2-methyl-N-[2-(methylamino)ethyl]benzamide (PubChem CID 119502214) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)sulfamoyl]-2-methyl-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 5-[(2-methoxyphenyl)sulfamoyl]-2-methyl-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119502214 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[(2-methoxyphenyl)sulfamoyl]-2-methyl-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cc(S(=O)(=O)Nc2ccccc2OC)ccc1C |
| InChI | InChI=1S/C18H23N3O4S/c1-13-8-9-14(12-15(13)18(22)20-11-10-19-2)26(23,24)21-16-6-4-5-7-17(16)25-3/h4-9,12,19,21H,10-11H2,1-3H3,(H,20,22) |
| InChIKey | BDCZAQPXEXFOKH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|