C27H27Cl2F3N4O4S — CID 59849958
3-[[5-chloro-3-[[3-chloro-4-(trifluoromethyl)phenyl]sulfonylamino]-2-pyridinyl]oxy]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 59849958) has the molecular formula C27H27Cl2F3N4O4S and a molecular weight of 631.50 g/mol. Its IUPAC name is 3-[[5-chloro-3-[[3-chloro-4-(trifluoromethyl)phenyl]sulfonylamino]-2-pyridinyl]oxy]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 3-[[5-chloro-3-[[3-chloro-4-(trifluoromethyl)phenyl]sulfonylamino]-2-pyridinyl]oxy]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 59849958 |
| Molecular Formula | C27H27Cl2F3N4O4S |
| Molecular Weight | 631.50 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | 3-[[5-chloro-3-[[3-chloro-4-(trifluoromethyl)phenyl]sulfonylamino]-2-pyridinyl]oxy]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCCC1)c1cccc(Oc2ncc(Cl)cc2NS(=O)(=O)c2ccc(C(F)(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C27H27Cl2F3N4O4S/c28-19-15-24(35-41(38,39)21-8-9-22(23(29)16-21)27(30,31)32)26(34-17-19)40-20-7-4-6-18(14-20)25(37)33-10-5-13-36-11-2-1-3-12-36/h4,6-9,14-17,35H,1-3,5,10-13H2,(H,33,37) |
| InChIKey | VVEWQPGUXIZPKD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|