C27H29Cl2N3O4S — CID 68529823
4-[[2-(3,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 68529823) has the molecular formula C27H29Cl2N3O4S and a molecular weight of 562.52 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[[2-(3,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 68529823 |
| Molecular Formula | C27H29Cl2N3O4S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenoxy)phenyl]sulfamoyl]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCCC1)c1ccc(S(=O)(=O)Nc2ccccc2Oc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H29Cl2N3O4S/c28-23-14-11-21(19-24(23)29)36-26-8-3-2-7-25(26)31-37(34,35)22-12-9-20(10-13-22)27(33)30-15-6-18-32-16-4-1-5-17-32/h2-3,7-14,19,31H,1,4-6,15-18H2,(H,30,33) |
| InChIKey | YVHKRISXDOPPFS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|